Boronic acid, B-[4-fluoro-2-(1-methylethoxy)phenyl]-
[4-fluoro-2-(1-methylethoxy)phenyl]boronic acid
CAS: 480438-59-3
Molecular Formula: C9H12BFO3
Boronic acid, B-[4-fluoro-2-(1-methylethoxy)phenyl]- - Names and Identifiers
| Name | [4-fluoro-2-(1-methylethoxy)phenyl]boronic acid |
| Synonyms | 4-FLUORO-2-ISOPROPOXYPHENYLBORONIC ACID 4-Fluoro-2-[(prop-2-yl)oxy]benzeneboronic acid [4-fluoro-2-(1-methylethoxy)phenyl]boronic acid Boronic acid, B-[4-fluoro-2-(1-methylethoxy)phenyl]- |
| CAS | 480438-59-3 |
| InChI | InChI=1/C9H12BFO3/c1-6(2)14-9-5-7(11)3-4-8(9)10(12)13/h3-6,12-13H,1-2H3 |
Boronic acid, B-[4-fluoro-2-(1-methylethoxy)phenyl]- - Physico-chemical Properties
| Molecular Formula | C9H12BFO3 |
| Molar Mass | 198 |
| Density | 1.17g/cm3 |
| Melting Point | 101-106°C(lit.) |
| Boling Point | 312.7°C at 760 mmHg |
| Flash Point | 142.9°C |
| Vapor Presure | 0.000222mmHg at 25°C |
| Appearance | Solid |
| Storage Condition | Inert atmosphere,Store in freezer, under -20°C |
| Refractive Index | 1.495 |
Boronic acid, B-[4-fluoro-2-(1-methylethoxy)phenyl]- - Risk and Safety
| WGK Germany | 3 |
Boronic acid, B-[4-fluoro-2-(1-methylethoxy)phenyl]- - Introduction
[4-fluoro-2-(1-methyllethoxy) phenyl]boronic acid is an organic compound with the molecular formula C10H13BFO3, which has some of the following properties:
1. Appearance:[4-fluoro-2-(1-methyllethoxy) phenyl]boronic acid is colorless crystal or white powder.
2. solubility: in common organic solvents such as methanol, ethanol can be dissolved.
3. Melting point: about 90-95°C.
4. use:[4-fluoro-2-(1-methyllethoxy) phenyl]boronic acid is an organic boron reagent, which is commonly used as a ligand in palladium-catalyzed reactions in organic synthesis. It can be reacted with halogenated hydrocarbons of different functional groups, for example, aromatic ether compounds, phenyl ketones, amides and other compounds can be prepared.
5. preparation method:[4-fluoro-2-(1-methyllethoxy) phenyl]boronic acid can be obtained by reacting with suitable boron reagent and 4-fluoro-2-isopropoxyphenyl halogenated hydrocarbon under appropriate conditions.
6. safety information: at present, there is little safety information about [4-fluoro-2-(1-methyllethoxy) phenyl]boronic acid, but according to the common sense of general chemicals, routine laboratory operation and safety measures should be followed, such as wearing protective gloves and glasses. During use and storage, it is necessary to avoid contact with strong oxidants, strong acids, strong bases and other substances to prevent unsafe reactions.
1. Appearance:[4-fluoro-2-(1-methyllethoxy) phenyl]boronic acid is colorless crystal or white powder.
2. solubility: in common organic solvents such as methanol, ethanol can be dissolved.
3. Melting point: about 90-95°C.
4. use:[4-fluoro-2-(1-methyllethoxy) phenyl]boronic acid is an organic boron reagent, which is commonly used as a ligand in palladium-catalyzed reactions in organic synthesis. It can be reacted with halogenated hydrocarbons of different functional groups, for example, aromatic ether compounds, phenyl ketones, amides and other compounds can be prepared.
5. preparation method:[4-fluoro-2-(1-methyllethoxy) phenyl]boronic acid can be obtained by reacting with suitable boron reagent and 4-fluoro-2-isopropoxyphenyl halogenated hydrocarbon under appropriate conditions.
6. safety information: at present, there is little safety information about [4-fluoro-2-(1-methyllethoxy) phenyl]boronic acid, but according to the common sense of general chemicals, routine laboratory operation and safety measures should be followed, such as wearing protective gloves and glasses. During use and storage, it is necessary to avoid contact with strong oxidants, strong acids, strong bases and other substances to prevent unsafe reactions.
Last Update：2024-04-10 22:29:15
![Boronic acid, B-[4-fluoro-2-(1-methylethoxy)phenyl]-](http://res.chembk.com/assets/images/structure/480438-59-3.gif)